hcalle28 hcalle28

28-03-2021
Mathematics

contestada

173 The midpoint between x and a is m. What is x ?

Respuesta :

28-03-2021

If so, [tex]m=\frac{x+a}{2}[/tex] when solved for x will yield [tex]x=2m-a[/tex].

Hope this helps.

Answer Link

Otras preguntas

A Carnot engine has an efficiency of 83.0% and performs 4500 J of work every cycle. How much energy is discharged to the lower temperature reservoir every cycle

Lamar plans to watch 2 movies each month.write an equation represent the total number of movies n that he will watch I m moths

paragraph about child labour in bangladesh

Evaluate g(x) = 0.023x3 + 0.4x2 − 2.1x + 8.3 for x = 2 and x = 4.

A certain drug dosage calls for 14 mg per kg per day and is divided into two doses (1 every 12 hours). If a person weighs 242 pounds, how many milligrams of the

A solution is prepared by dissolving 5g HNO3 in pure water to a total volume of 1L. a) WHat is the pH b) What mass of strong base sodium hydroxide (NaOH) woul

Derive these identities using the addition or subtraction formulas for sine or cosine: sinacosb=(sin(a+b)+sin(a-b))/2

Let L1 be the line passing through the points Q1(−4, 4, 3) and Q2(0, 10, 1) and let L2 be the line passing through the point P1(3, 20, 0) with direction vector

After examining small paint chips from an auto accident scene and using the PDQ database, the crime lab worker can determine the _____ of the vehicle. a. Model

In macroeconomics, a _______________ describes the common way in which market values are measured in an economy (Money acts as a common denominator, an accounti